C21H28O2Si — CID 11078347
tert-butyl-dimethyl-[(S)-phenyl-[(2R,3S)-3-phenyloxiran-2-yl]methoxy]silane (PubChem CID 11078347) has the molecular formula C21H28O2Si and a molecular weight of 340.54 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(S)-phenyl-[(2R,3S)-3-phenyloxiran-2-yl]methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(S)-phenyl-[(2R,3S)-3-phenyloxiran-2-yl]methoxy]silane |
|---|---|
| PubChem CID | 11078347 |
| Molecular Formula | C21H28O2Si |
| Molecular Weight | 340.54 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | tert-butyl-dimethyl-[(S)-phenyl-[(2R,3S)-3-phenyloxiran-2-yl]methoxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](c1ccccc1)[C@@H]1O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C21H28O2Si/c1-21(2,3)24(4,5)23-19(17-14-10-7-11-15-17)20-18(22-20)16-12-8-6-9-13-16/h6-15,18-20H,1-5H3/t18-,19-,20+/m0/s1 |
| InChIKey | FHYBHKLQQXGGET-SLFFLAALSA-N |
| XLogP | 5.89 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.54 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|