C22H36O5Si — CID 24767034
(5S)-5-[(4R,5S)-5-[(S)-[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]oxolan-2-ol (PubChem CID 24767034) has the molecular formula C22H36O5Si and a molecular weight of 408.61 g/mol. Its IUPAC name is (5S)-5-[(4R,5S)-5-[(S)-[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]oxolan-2-ol.
| Compound Name | (5S)-5-[(4R,5S)-5-[(S)-[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]oxolan-2-ol |
|---|---|
| PubChem CID | 24767034 |
| Molecular Formula | C22H36O5Si |
| Molecular Weight | 408.61 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | (5S)-5-[(4R,5S)-5-[(S)-[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]oxolan-2-ol |
| SMILES | CC1(C)O[C@H]([C@@H]2CCC(O)O2)[C@@H]([C@@H](O[Si](C)(C)C(C)(C)C)c2ccccc2)O1 |
| InChI | InChI=1S/C22H36O5Si/c1-21(2,3)28(6,7)27-18(15-11-9-8-10-12-15)20-19(25-22(4,5)26-20)16-13-14-17(23)24-16/h8-12,16-20,23H,13-14H2,1-7H3/t16-,17?,18-,19+,20+/m0/s1 |
| InChIKey | PNFMFUYSHYJXQD-FCFHUKJJSA-N |
| XLogP | 4.77 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.61 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|