C30H45NO4Si — CID 10553778
(4R)-4-[(3aR,4S,6aS)-5-benzhydryl-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]-4-[tert-butyl(dimethyl)silyl]oxybutan-1-ol (PubChem CID 10553778) has the molecular formula C30H45NO4Si and a molecular weight of 511.78 g/mol. Its IUPAC name is (4R)-4-[(3aR,4S,6aS)-5-benzhydryl-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]-4-[tert-butyl(dimethyl)silyl]oxybutan-1-ol.
| Compound Name | (4R)-4-[(3aR,4S,6aS)-5-benzhydryl-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]-4-[tert-butyl(dimethyl)silyl]oxybutan-1-ol |
|---|---|
| PubChem CID | 10553778 |
| Molecular Formula | C30H45NO4Si |
| Molecular Weight | 511.78 g/mol |
| Exact Mass | 511.31 |
| IUPAC Name | (4R)-4-[(3aR,4S,6aS)-5-benzhydryl-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]-4-[tert-butyl(dimethyl)silyl]oxybutan-1-ol |
| SMILES | CC1(C)O[C@@H]2[C@@H]([C@@H](CCCO)O[Si](C)(C)C(C)(C)C)N(C(c3ccccc3)c3ccccc3)C[C@@H]2O1 |
| InChI | InChI=1S/C30H45NO4Si/c1-29(2,3)36(6,7)35-24(19-14-20-32)27-28-25(33-30(4,5)34-28)21-31(27)26(22-15-10-8-11-16-22)23-17-12-9-13-18-23/h8-13,15-18,24-28,32H,14,19-21H2,1-7H3/t24-,25+,27-,28+/m1/s1 |
| InChIKey | VENRRMQJEQRDDK-PSXRRJEGSA-N |
| XLogP | 6.14 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.78 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|