C24H37NO4Si — CID 59100084
(3aR,7R,9R,9aS,9bS)-7-benzyl-9-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4,7,8,9,9a,9b-hexahydro-3aH-[1,3]dioxolo[4,5-a]indolizin-6-one (PubChem CID 59100084) has the molecular formula C24H37NO4Si and a molecular weight of 431.65 g/mol. Its IUPAC name is (3aR,7R,9R,9aS,9bS)-7-benzyl-9-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4,7,8,9,9a,9b-hexahydro-3aH-[1,3]dioxolo[4,5-a]indolizin-6-one.
| Compound Name | (3aR,7R,9R,9aS,9bS)-7-benzyl-9-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4,7,8,9,9a,9b-hexahydro-3aH-[1,3]dioxolo[4,5-a]indolizin-6-one |
|---|---|
| PubChem CID | 59100084 |
| Molecular Formula | C24H37NO4Si |
| Molecular Weight | 431.65 g/mol |
| Exact Mass | 431.25 |
| IUPAC Name | (3aR,7R,9R,9aS,9bS)-7-benzyl-9-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4,7,8,9,9a,9b-hexahydro-3aH-[1,3]dioxolo[4,5-a]indolizin-6-one |
| SMILES | CC1(C)O[C@H]2[C@H]3[C@H](O[Si](C)(C)C(C)(C)C)C[C@@H](Cc4ccccc4)C(=O)N3C[C@H]2O1 |
| InChI | InChI=1S/C24H37NO4Si/c1-23(2,3)30(6,7)29-18-14-17(13-16-11-9-8-10-12-16)22(26)25-15-19-21(20(18)25)28-24(4,5)27-19/h8-12,17-21H,13-15H2,1-7H3/t17-,18-,19-,20-,21-/m1/s1 |
| InChIKey | CPRIWUFJCDAHOS-PFAUGDHASA-N |
| XLogP | 4.37 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.65 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|