C25H43NO3Si2 — CID 11719572
(1R,4S,5S,6S)-2-benzyl-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-2-azabicyclo[2.2.1]heptan-3-one (PubChem CID 11719572) has the molecular formula C25H43NO3Si2 and a molecular weight of 461.80 g/mol. Its IUPAC name is (1R,4S,5S,6S)-2-benzyl-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-2-azabicyclo[2.2.1]heptan-3-one.
| Compound Name | (1R,4S,5S,6S)-2-benzyl-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-2-azabicyclo[2.2.1]heptan-3-one |
|---|---|
| PubChem CID | 11719572 |
| Molecular Formula | C25H43NO3Si2 |
| Molecular Weight | 461.80 g/mol |
| Exact Mass | 461.28 |
| IUPAC Name | (1R,4S,5S,6S)-2-benzyl-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-2-azabicyclo[2.2.1]heptan-3-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2C[C@@H]1C(=O)N2Cc1ccccc1 |
| InChI | InChI=1S/C25H43NO3Si2/c1-24(2,3)30(7,8)28-21-19-16-20(22(21)29-31(9,10)25(4,5)6)26(23(19)27)17-18-14-12-11-13-15-18/h11-15,19-22H,16-17H2,1-10H3/t19-,20+,21-,22-/m0/s1 |
| InChIKey | MCDOIUQHFZKUPJ-LRSLUSHPSA-N |
| XLogP | 6.20 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.80 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|