C20H31NOSi — CID 102324960
[(1S,5R)-8-benzyl-8-azabicyclo[3.2.1]oct-6-en-3-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 102324960) has the molecular formula C20H31NOSi and a molecular weight of 329.56 g/mol. Its IUPAC name is [(1S,5R)-8-benzyl-8-azabicyclo[3.2.1]oct-6-en-3-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1S,5R)-8-benzyl-8-azabicyclo[3.2.1]oct-6-en-3-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 102324960 |
| Molecular Formula | C20H31NOSi |
| Molecular Weight | 329.56 g/mol |
| Exact Mass | 329.22 |
| IUPAC Name | [(1S,5R)-8-benzyl-8-azabicyclo[3.2.1]oct-6-en-3-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC1C[C@H]2C=C[C@@H](C1)N2Cc1ccccc1 |
| InChI | InChI=1S/C20H31NOSi/c1-20(2,3)23(4,5)22-19-13-17-11-12-18(14-19)21(17)15-16-9-7-6-8-10-16/h6-12,17-19H,13-15H2,1-5H3/t17-,18+,19? |
| InChIKey | PLWPKHMOGJRWGA-DFNIBXOVSA-N |
| XLogP | 4.98 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.56 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|