C25H42N2O3Si — CID 170947422
tert-butyl 9-benzyl-7-[tert-butyl(dimethyl)silyl]oxy-3,9-diazabicyclo[3.3.1]nonane-3-carboxylate (PubChem CID 170947422) has the molecular formula C25H42N2O3Si and a molecular weight of 446.71 g/mol. Its IUPAC name is tert-butyl 9-benzyl-7-[tert-butyl(dimethyl)silyl]oxy-3,9-diazabicyclo[3.3.1]nonane-3-carboxylate.
| Compound Name | tert-butyl 9-benzyl-7-[tert-butyl(dimethyl)silyl]oxy-3,9-diazabicyclo[3.3.1]nonane-3-carboxylate |
|---|---|
| PubChem CID | 170947422 |
| Molecular Formula | C25H42N2O3Si |
| Molecular Weight | 446.71 g/mol |
| Exact Mass | 446.30 |
| IUPAC Name | tert-butyl 9-benzyl-7-[tert-butyl(dimethyl)silyl]oxy-3,9-diazabicyclo[3.3.1]nonane-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2CC(O[Si](C)(C)C(C)(C)C)CC(C1)N2Cc1ccccc1 |
| InChI | InChI=1S/C25H42N2O3Si/c1-24(2,3)29-23(28)26-17-20-14-22(30-31(7,8)25(4,5)6)15-21(18-26)27(20)16-19-12-10-9-11-13-19/h9-13,20-22H,14-18H2,1-8H3 |
| InChIKey | NAWPIMVRDHWHME-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.71 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|