C31H46N2O3Si — CID 86589638
tert-butyl (7R,8aS)-4-benzhydryl-7-[tert-butyl(dimethyl)silyl]oxy-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxylate (PubChem CID 86589638) has the molecular formula C31H46N2O3Si and a molecular weight of 522.81 g/mol. Its IUPAC name is tert-butyl (7R,8aS)-4-benzhydryl-7-[tert-butyl(dimethyl)silyl]oxy-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxylate.
| Compound Name | tert-butyl (7R,8aS)-4-benzhydryl-7-[tert-butyl(dimethyl)silyl]oxy-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 86589638 |
| Molecular Formula | C31H46N2O3Si |
| Molecular Weight | 522.81 g/mol |
| Exact Mass | 522.33 |
| IUPAC Name | tert-butyl (7R,8aS)-4-benzhydryl-7-[tert-butyl(dimethyl)silyl]oxy-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(C(c2ccccc2)c2ccccc2)N2C[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]2C1 |
| InChI | InChI=1S/C31H46N2O3Si/c1-30(2,3)35-29(34)32-20-25-19-26(36-37(7,8)31(4,5)6)21-33(25)27(22-32)28(23-15-11-9-12-16-23)24-17-13-10-14-18-24/h9-18,25-28H,19-22H2,1-8H3/t25-,26+,27?/m0/s1 |
| InChIKey | VHCNIWOMDINGCI-AJRFNQODSA-N |
| XLogP | 6.90 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.81 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|