C30H39N3O4 — CID 91031953
tert-butyl (4R,9aS)-4-benzhydryl-8-[(2S)-oxolane-2-carbonyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine-2-carboxylate (PubChem CID 91031953) has the molecular formula C30H39N3O4 and a molecular weight of 505.66 g/mol. Its IUPAC name is tert-butyl (4R,9aS)-4-benzhydryl-8-[(2S)-oxolane-2-carbonyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine-2-carboxylate.
| Compound Name | tert-butyl (4R,9aS)-4-benzhydryl-8-[(2S)-oxolane-2-carbonyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 91031953 |
| Molecular Formula | C30H39N3O4 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.29 |
| IUPAC Name | tert-butyl (4R,9aS)-4-benzhydryl-8-[(2S)-oxolane-2-carbonyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2CN(C(=O)[C@@H]3CCCO3)CCN2[C@H](C(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C30H39N3O4/c1-30(2,3)37-29(35)32-20-24-19-31(28(34)26-15-10-18-36-26)16-17-33(24)25(21-32)27(22-11-6-4-7-12-22)23-13-8-5-9-14-23/h4-9,11-14,24-27H,10,15-21H2,1-3H3/t24-,25-,26-/m0/s1 |
| InChIKey | JSYUOKKDKSTKFK-GSDHBNRESA-N |
| XLogP | 4.13 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |