C24H39NO4S2Si — CID 22881083
tert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[methylsulfanylcarbothioyloxy(phenyl)methyl]pyrrolidine-1-carboxylate (PubChem CID 22881083) has the molecular formula C24H39NO4S2Si and a molecular weight of 497.80 g/mol. Its IUPAC name is tert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[methylsulfanylcarbothioyloxy(phenyl)methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[methylsulfanylcarbothioyloxy(phenyl)methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 22881083 |
| Molecular Formula | C24H39NO4S2Si |
| Molecular Weight | 497.80 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | tert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[methylsulfanylcarbothioyloxy(phenyl)methyl]pyrrolidine-1-carboxylate |
| SMILES | CSC(=S)OC(c1ccccc1)[C@@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H39NO4S2Si/c1-23(2,3)28-21(26)25-16-18(29-32(8,9)24(4,5)6)15-19(25)20(27-22(30)31-7)17-13-11-10-12-14-17/h10-14,18-20H,15-16H2,1-9H3/t18-,19+,20?/m1/s1 |
| InChIKey | HCRYUVKGMUNLDU-LFPSWIHMSA-N |
| XLogP | 6.79 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.80 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|