C24H41NO3Si — CID 58303355
tert-butyl 2-[(3S,5R)-1-benzyl-5-[tert-butyl(dimethyl)silyl]oxypiperidin-3-yl]acetate (PubChem CID 58303355) has the molecular formula C24H41NO3Si and a molecular weight of 419.68 g/mol. Its IUPAC name is tert-butyl 2-[(3S,5R)-1-benzyl-5-[tert-butyl(dimethyl)silyl]oxypiperidin-3-yl]acetate.
| Compound Name | tert-butyl 2-[(3S,5R)-1-benzyl-5-[tert-butyl(dimethyl)silyl]oxypiperidin-3-yl]acetate |
|---|---|
| PubChem CID | 58303355 |
| Molecular Formula | C24H41NO3Si |
| Molecular Weight | 419.68 g/mol |
| Exact Mass | 419.29 |
| IUPAC Name | tert-butyl 2-[(3S,5R)-1-benzyl-5-[tert-butyl(dimethyl)silyl]oxypiperidin-3-yl]acetate |
| SMILES | CC(C)(C)OC(=O)C[C@@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)CN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C24H41NO3Si/c1-23(2,3)27-22(26)15-20-14-21(28-29(7,8)24(4,5)6)18-25(17-20)16-19-12-10-9-11-13-19/h9-13,20-21H,14-18H2,1-8H3/t20-,21+/m0/s1 |
| InChIKey | RNQHLGYTZWFRQZ-LEWJYISDSA-N |
| XLogP | 5.63 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.68 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|