C20H31NO2 — CID 58266905
tert-butyl 3-(1-benzyl-4-ethylpyrrolidin-3-yl)propanoate (PubChem CID 58266905) has the molecular formula C20H31NO2 and a molecular weight of 317.47 g/mol. Its IUPAC name is tert-butyl 3-(1-benzyl-4-ethylpyrrolidin-3-yl)propanoate.
| Compound Name | tert-butyl 3-(1-benzyl-4-ethylpyrrolidin-3-yl)propanoate |
|---|---|
| PubChem CID | 58266905 |
| Molecular Formula | C20H31NO2 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.24 |
| IUPAC Name | tert-butyl 3-(1-benzyl-4-ethylpyrrolidin-3-yl)propanoate |
| SMILES | CCC1CN(Cc2ccccc2)CC1CCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H31NO2/c1-5-17-14-21(13-16-9-7-6-8-10-16)15-18(17)11-12-19(22)23-20(2,3)4/h6-10,17-18H,5,11-15H2,1-4H3 |
| InChIKey | IFOONQFMXYDVFH-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |