C14H21N — CID 58977345
(3R,4S)-1-benzyl-3-ethyl-4-methylpyrrolidine (PubChem CID 58977345) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is (3R,4S)-1-benzyl-3-ethyl-4-methylpyrrolidine.
| Compound Name | (3R,4S)-1-benzyl-3-ethyl-4-methylpyrrolidine |
|---|---|
| PubChem CID | 58977345 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | (3R,4S)-1-benzyl-3-ethyl-4-methylpyrrolidine |
| SMILES | CC[C@H]1CN(Cc2ccccc2)C[C@H]1C |
| InChI | InChI=1S/C14H21N/c1-3-14-11-15(9-12(14)2)10-13-7-5-4-6-8-13/h4-8,12,14H,3,9-11H2,1-2H3/t12-,14+/m1/s1 |
| InChIKey | SLIZTSAPBMDWMO-OCCSQVGLSA-N |
| XLogP | 3.16 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |