C14H20BrN — CID 97176892
(3R,5R)-1-benzyl-4-bromo-3,5-dimethylpiperidine (PubChem CID 97176892) has the molecular formula C14H20BrN and a molecular weight of 282.22 g/mol. Its IUPAC name is (3R,5R)-1-benzyl-4-bromo-3,5-dimethylpiperidine.
| Compound Name | (3R,5R)-1-benzyl-4-bromo-3,5-dimethylpiperidine |
|---|---|
| PubChem CID | 97176892 |
| Molecular Formula | C14H20BrN |
| Molecular Weight | 282.22 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | (3R,5R)-1-benzyl-4-bromo-3,5-dimethylpiperidine |
| SMILES | C[C@@H]1CN(Cc2ccccc2)C[C@@H](C)C1Br |
| InChI | InChI=1S/C14H20BrN/c1-11-8-16(9-12(2)14(11)15)10-13-6-4-3-5-7-13/h3-7,11-12,14H,8-10H2,1-2H3/t11-,12-/m1/s1 |
| InChIKey | FKRZSQPJTOOSAV-VXGBXAGGSA-N |
| XLogP | 3.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.22 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|