C14H19NO — CID 56828035
(3R,5R)-1-benzyl-3,5-dimethylpiperidin-4-one (PubChem CID 56828035) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is (3R,5R)-1-benzyl-3,5-dimethylpiperidin-4-one.
| Compound Name | (3R,5R)-1-benzyl-3,5-dimethylpiperidin-4-one |
|---|---|
| PubChem CID | 56828035 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | (3R,5R)-1-benzyl-3,5-dimethylpiperidin-4-one |
| SMILES | C[C@@H]1CN(Cc2ccccc2)C[C@@H](C)C1=O |
| InChI | InChI=1S/C14H19NO/c1-11-8-15(9-12(2)14(11)16)10-13-6-4-3-5-7-13/h3-7,11-12H,8-10H2,1-2H3/t11-,12-/m1/s1 |
| InChIKey | KUUYMZATYJQLLZ-VXGBXAGGSA-N |
| XLogP | 2.34 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |