C14H21NO2 — CID 143088563
(3S,5R)-1-benzyl-3,5-dimethylpiperidine-4,4-diol (PubChem CID 143088563) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is (3S,5R)-1-benzyl-3,5-dimethylpiperidine-4,4-diol.
| Compound Name | (3S,5R)-1-benzyl-3,5-dimethylpiperidine-4,4-diol |
|---|---|
| PubChem CID | 143088563 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | (3S,5R)-1-benzyl-3,5-dimethylpiperidine-4,4-diol |
| SMILES | C[C@@H]1CN(Cc2ccccc2)C[C@H](C)C1(O)O |
| InChI | InChI=1S/C14H21NO2/c1-11-8-15(9-12(2)14(11,16)17)10-13-6-4-3-5-7-13/h3-7,11-12,16-17H,8-10H2,1-2H3/t11-,12+ |
| InChIKey | JOXKNNONEHDQRG-TXEJJXNPSA-N |
| XLogP | 1.46 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|