C20H31NO — CID 59130980
(3R,5S)-1-benzyl-4-cyclohexyl-3,5-dimethylpiperidin-4-ol (PubChem CID 59130980) has the molecular formula C20H31NO and a molecular weight of 301.47 g/mol. Its IUPAC name is (3R,5S)-1-benzyl-4-cyclohexyl-3,5-dimethylpiperidin-4-ol.
| Compound Name | (3R,5S)-1-benzyl-4-cyclohexyl-3,5-dimethylpiperidin-4-ol |
|---|---|
| PubChem CID | 59130980 |
| Molecular Formula | C20H31NO |
| Molecular Weight | 301.47 g/mol |
| Exact Mass | 301.24 |
| IUPAC Name | (3R,5S)-1-benzyl-4-cyclohexyl-3,5-dimethylpiperidin-4-ol |
| SMILES | C[C@@H]1CN(Cc2ccccc2)C[C@H](C)C1(O)C1CCCCC1 |
| InChI | InChI=1S/C20H31NO/c1-16-13-21(15-18-9-5-3-6-10-18)14-17(2)20(16,22)19-11-7-4-8-12-19/h3,5-6,9-10,16-17,19,22H,4,7-8,11-15H2,1-2H3/t16-,17+,20? |
| InChIKey | HZILZGNAXUIFRX-XEWABKELSA-N |
| XLogP | 4.09 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.47 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |