C14H17F2N — CID 176801204
3-benzyl-8,8-difluoro-3-azabicyclo[3.2.1]octane (PubChem CID 176801204) has the molecular formula C14H17F2N and a molecular weight of 237.29 g/mol. Its IUPAC name is 3-benzyl-8,8-difluoro-3-azabicyclo[3.2.1]octane.
| Compound Name | 3-benzyl-8,8-difluoro-3-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 176801204 |
| Molecular Formula | C14H17F2N |
| Molecular Weight | 237.29 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 3-benzyl-8,8-difluoro-3-azabicyclo[3.2.1]octane |
| SMILES | FC1(F)C2CCC1CN(Cc1ccccc1)C2 |
| InChI | InChI=1S/C14H17F2N/c15-14(16)12-6-7-13(14)10-17(9-12)8-11-4-2-1-3-5-11/h1-5,12-13H,6-10H2 |
| InChIKey | JAFGHXGCKZWYMC-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.29 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |