C20H22ClNO — CID 10969498
(1R,5S)-3-benzyl-8-(4-chlorophenyl)-3-azabicyclo[3.2.1]octan-8-ol (PubChem CID 10969498) has the molecular formula C20H22ClNO and a molecular weight of 327.86 g/mol. Its IUPAC name is (1R,5S)-3-benzyl-8-(4-chlorophenyl)-3-azabicyclo[3.2.1]octan-8-ol.
| Compound Name | (1R,5S)-3-benzyl-8-(4-chlorophenyl)-3-azabicyclo[3.2.1]octan-8-ol |
|---|---|
| PubChem CID | 10969498 |
| Molecular Formula | C20H22ClNO |
| Molecular Weight | 327.86 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | (1R,5S)-3-benzyl-8-(4-chlorophenyl)-3-azabicyclo[3.2.1]octan-8-ol |
| SMILES | OC1(c2ccc(Cl)cc2)[C@@H]2CC[C@H]1CN(Cc1ccccc1)C2 |
| InChI | InChI=1S/C20H22ClNO/c21-19-10-8-16(9-11-19)20(23)17-6-7-18(20)14-22(13-17)12-15-4-2-1-3-5-15/h1-5,8-11,17-18,23H,6-7,12-14H2/t17-,18+,20? |
| InChIKey | WTEIJIHIMKEQPY-UFRUDQCGSA-N |
| XLogP | 4.07 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.86 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |