C21H31NO2 — CID 177342640
ethyl 1-benzyl-4-cyclohexylpiperidine-4-carboxylate (PubChem CID 177342640) has the molecular formula C21H31NO2 and a molecular weight of 329.48 g/mol. Its IUPAC name is ethyl 1-benzyl-4-cyclohexylpiperidine-4-carboxylate.
| Compound Name | ethyl 1-benzyl-4-cyclohexylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 177342640 |
| Molecular Formula | C21H31NO2 |
| Molecular Weight | 329.48 g/mol |
| Exact Mass | 329.24 |
| IUPAC Name | ethyl 1-benzyl-4-cyclohexylpiperidine-4-carboxylate |
| SMILES | CCOC(=O)C1(C2CCCCC2)CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H31NO2/c1-2-24-20(23)21(19-11-7-4-8-12-19)13-15-22(16-14-21)17-18-9-5-3-6-10-18/h3,5-6,9-10,19H,2,4,7-8,11-17H2,1H3 |
| InChIKey | ILXLTXAQDPYLQJ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.48 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |