C16H22ClN — CID 3396845
2-benzyl-4a-chloro-1,3,4,5,6,7,8,8a-octahydroisoquinoline (PubChem CID 3396845) has the molecular formula C16H22ClN and a molecular weight of 263.81 g/mol. Its IUPAC name is 2-benzyl-4a-chloro-1,3,4,5,6,7,8,8a-octahydroisoquinoline.
| Compound Name | 2-benzyl-4a-chloro-1,3,4,5,6,7,8,8a-octahydroisoquinoline |
|---|---|
| PubChem CID | 3396845 |
| Molecular Formula | C16H22ClN |
| Molecular Weight | 263.81 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 2-benzyl-4a-chloro-1,3,4,5,6,7,8,8a-octahydroisoquinoline |
| SMILES | ClC12CCCCC1CN(Cc1ccccc1)CC2 |
| InChI | InChI=1S/C16H22ClN/c17-16-9-5-4-8-15(16)13-18(11-10-16)12-14-6-2-1-3-7-14/h1-3,6-7,15H,4-5,8-13H2 |
| InChIKey | PMKLHZABYQCVLG-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.81 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|