C15H19NO2 — CID 10776768
(4aR,7aR)-2-benzyl-4a-hydroxy-1,3,4,6,7,7a-hexahydrocyclopenta[c]pyridin-5-one (PubChem CID 10776768) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is (4aR,7aR)-2-benzyl-4a-hydroxy-1,3,4,6,7,7a-hexahydrocyclopenta[c]pyridin-5-one.
| Compound Name | (4aR,7aR)-2-benzyl-4a-hydroxy-1,3,4,6,7,7a-hexahydrocyclopenta[c]pyridin-5-one |
|---|---|
| PubChem CID | 10776768 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | (4aR,7aR)-2-benzyl-4a-hydroxy-1,3,4,6,7,7a-hexahydrocyclopenta[c]pyridin-5-one |
| SMILES | O=C1CC[C@@H]2CN(Cc3ccccc3)CC[C@]12O |
| InChI | InChI=1S/C15H19NO2/c17-14-7-6-13-11-16(9-8-15(13,14)18)10-12-4-2-1-3-5-12/h1-5,13,18H,6-11H2/t13-,15-/m1/s1 |
| InChIKey | OMARDGCCGPLDCM-UKRRQHHQSA-N |
| XLogP | 1.60 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |