C18H26N2O — CID 165353165
3-benzyl-7-butyl-3,7-diazabicyclo[3.3.1]nonan-9-one (PubChem CID 165353165) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is 3-benzyl-7-butyl-3,7-diazabicyclo[3.3.1]nonan-9-one.
| Compound Name | 3-benzyl-7-butyl-3,7-diazabicyclo[3.3.1]nonan-9-one |
|---|---|
| PubChem CID | 165353165 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | 3-benzyl-7-butyl-3,7-diazabicyclo[3.3.1]nonan-9-one |
| SMILES | CCCCN1CC2CN(Cc3ccccc3)CC(C1)C2=O |
| InChI | InChI=1S/C18H26N2O/c1-2-3-9-19-11-16-13-20(14-17(12-19)18(16)21)10-15-7-5-4-6-8-15/h4-8,16-17H,2-3,9-14H2,1H3 |
| InChIKey | ZJJOGCGDHQXHNY-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |