C15H22ClN — CID 101182718
(3S,5S)-1-butyl-3-chloro-5-phenylpiperidine (PubChem CID 101182718) has the molecular formula C15H22ClN and a molecular weight of 251.80 g/mol. Its IUPAC name is (3S,5S)-1-butyl-3-chloro-5-phenylpiperidine.
| Compound Name | (3S,5S)-1-butyl-3-chloro-5-phenylpiperidine |
|---|---|
| PubChem CID | 101182718 |
| Molecular Formula | C15H22ClN |
| Molecular Weight | 251.80 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | (3S,5S)-1-butyl-3-chloro-5-phenylpiperidine |
| SMILES | CCCCN1C[C@@H](Cl)C[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C15H22ClN/c1-2-3-9-17-11-14(10-15(16)12-17)13-7-5-4-6-8-13/h4-8,14-15H,2-3,9-12H2,1H3/t14-,15+/m1/s1 |
| InChIKey | XEHRLZREDAFZLB-CABCVRRESA-N |
| XLogP | 3.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.80 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|