C22H33NO4 — CID 58266915
tert-butyl 1-benzyl-4-(4-ethoxy-4-oxobutyl)pyrrolidine-3-carboxylate (PubChem CID 58266915) has the molecular formula C22H33NO4 and a molecular weight of 375.51 g/mol. Its IUPAC name is tert-butyl 1-benzyl-4-(4-ethoxy-4-oxobutyl)pyrrolidine-3-carboxylate.
| Compound Name | tert-butyl 1-benzyl-4-(4-ethoxy-4-oxobutyl)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 58266915 |
| Molecular Formula | C22H33NO4 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | tert-butyl 1-benzyl-4-(4-ethoxy-4-oxobutyl)pyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)CCCC1CN(Cc2ccccc2)CC1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H33NO4/c1-5-26-20(24)13-9-12-18-15-23(14-17-10-7-6-8-11-17)16-19(18)21(25)27-22(2,3)4/h6-8,10-11,18-19H,5,9,12-16H2,1-4H3 |
| InChIKey | XYJXJSPPIROAFT-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |