C25H34N2O2 — CID 141319735
ethyl 4-[(3S,4S)-1-benzyl-4-[[(1R)-1-phenylethyl]amino]pyrrolidin-3-yl]butanoate (PubChem CID 141319735) has the molecular formula C25H34N2O2 and a molecular weight of 394.56 g/mol. Its IUPAC name is ethyl 4-[(3S,4S)-1-benzyl-4-[[(1R)-1-phenylethyl]amino]pyrrolidin-3-yl]butanoate.
| Compound Name | ethyl 4-[(3S,4S)-1-benzyl-4-[[(1R)-1-phenylethyl]amino]pyrrolidin-3-yl]butanoate |
|---|---|
| PubChem CID | 141319735 |
| Molecular Formula | C25H34N2O2 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.26 |
| IUPAC Name | ethyl 4-[(3S,4S)-1-benzyl-4-[[(1R)-1-phenylethyl]amino]pyrrolidin-3-yl]butanoate |
| SMILES | CCOC(=O)CCC[C@H]1CN(Cc2ccccc2)C[C@H]1N[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C25H34N2O2/c1-3-29-25(28)16-10-15-23-18-27(17-21-11-6-4-7-12-21)19-24(23)26-20(2)22-13-8-5-9-14-22/h4-9,11-14,20,23-24,26H,3,10,15-19H2,1-2H3/t20-,23+,24-/m1/s1 |
| InChIKey | SFRPFCODQNOXCR-FGCOXFRFSA-N |
| XLogP | 4.57 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |