C25H39NO6 — CID 71905698
[1-benzyl-4-(4-ethoxybutanoyloxymethyl)pyrrolidin-3-yl]methyl 4-ethoxybutanoate (PubChem CID 71905698) has the molecular formula C25H39NO6 and a molecular weight of 449.59 g/mol. Its IUPAC name is [1-benzyl-4-(4-ethoxybutanoyloxymethyl)pyrrolidin-3-yl]methyl 4-ethoxybutanoate.
| Compound Name | [1-benzyl-4-(4-ethoxybutanoyloxymethyl)pyrrolidin-3-yl]methyl 4-ethoxybutanoate |
|---|---|
| PubChem CID | 71905698 |
| Molecular Formula | C25H39NO6 |
| Molecular Weight | 449.59 g/mol |
| Exact Mass | 449.28 |
| IUPAC Name | [1-benzyl-4-(4-ethoxybutanoyloxymethyl)pyrrolidin-3-yl]methyl 4-ethoxybutanoate |
| SMILES | CCOCCCC(=O)OCC1CN(Cc2ccccc2)CC1COC(=O)CCCOCC |
| InChI | InChI=1S/C25H39NO6/c1-3-29-14-8-12-24(27)31-19-22-17-26(16-21-10-6-5-7-11-21)18-23(22)20-32-25(28)13-9-15-30-4-2/h5-7,10-11,22-23H,3-4,8-9,12-20H2,1-2H3 |
| InChIKey | SRYZAWZGCOWURI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.59 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|