C18H27NO2 — CID 20662771
ethyl 1-benzyl-4-(2-methylpropyl)pyrrolidine-3-carboxylate (PubChem CID 20662771) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is ethyl 1-benzyl-4-(2-methylpropyl)pyrrolidine-3-carboxylate.
| Compound Name | ethyl 1-benzyl-4-(2-methylpropyl)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 20662771 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | ethyl 1-benzyl-4-(2-methylpropyl)pyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)C1CN(Cc2ccccc2)CC1CC(C)C |
| InChI | InChI=1S/C18H27NO2/c1-4-21-18(20)17-13-19(12-16(17)10-14(2)3)11-15-8-6-5-7-9-15/h5-9,14,16-17H,4,10-13H2,1-3H3 |
| InChIKey | HLSHZFREJKKUQG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |