C30H42BrNO6 — CID 68836087
ethyl (3S,4S)-1-benzyl-4-[2-[2-bromo-4-methoxy-5-(3-methoxypropoxy)phenoxy]-3-methylbutyl]pyrrolidine-3-carboxylate (PubChem CID 68836087) has the molecular formula C30H42BrNO6 and a molecular weight of 592.57 g/mol. Its IUPAC name is ethyl (3S,4S)-1-benzyl-4-[2-[2-bromo-4-methoxy-5-(3-methoxypropoxy)phenoxy]-3-methylbutyl]pyrrolidine-3-carboxylate.
| Compound Name | ethyl (3S,4S)-1-benzyl-4-[2-[2-bromo-4-methoxy-5-(3-methoxypropoxy)phenoxy]-3-methylbutyl]pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 68836087 |
| Molecular Formula | C30H42BrNO6 |
| Molecular Weight | 592.57 g/mol |
| Exact Mass | 591.22 |
| IUPAC Name | ethyl (3S,4S)-1-benzyl-4-[2-[2-bromo-4-methoxy-5-(3-methoxypropoxy)phenoxy]-3-methylbutyl]pyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CN(Cc2ccccc2)C[C@H]1CC(Oc1cc(OCCCOC)c(OC)cc1Br)C(C)C |
| InChI | InChI=1S/C30H42BrNO6/c1-6-36-30(33)24-20-32(18-22-11-8-7-9-12-22)19-23(24)15-26(21(2)3)38-27-17-29(37-14-10-13-34-4)28(35-5)16-25(27)31/h7-9,11-12,16-17,21,23-24,26H,6,10,13-15,18-20H2,1-5H3/t23-,24-,26?/m1/s1 |
| InChIKey | KRGMMPYSFHOQQK-LBHOTPKDSA-N |
| XLogP | 5.98 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.57 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|