C23H31NO4 — CID 75395316
[1-benzyl-4-(pent-4-enoyloxymethyl)pyrrolidin-3-yl]methyl pent-4-enoate (PubChem CID 75395316) has the molecular formula C23H31NO4 and a molecular weight of 385.50 g/mol. Its IUPAC name is [1-benzyl-4-(pent-4-enoyloxymethyl)pyrrolidin-3-yl]methyl pent-4-enoate.
| Compound Name | [1-benzyl-4-(pent-4-enoyloxymethyl)pyrrolidin-3-yl]methyl pent-4-enoate |
|---|---|
| PubChem CID | 75395316 |
| Molecular Formula | C23H31NO4 |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | [1-benzyl-4-(pent-4-enoyloxymethyl)pyrrolidin-3-yl]methyl pent-4-enoate |
| SMILES | C=CCCC(=O)OCC1CN(Cc2ccccc2)CC1COC(=O)CCC=C |
| InChI | InChI=1S/C23H31NO4/c1-3-5-12-22(25)27-17-20-15-24(14-19-10-8-7-9-11-19)16-21(20)18-28-23(26)13-6-4-2/h3-4,7-11,20-21H,1-2,5-6,12-18H2 |
| InChIKey | ACUMJCXWQGTCHO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|