C13H17Cl2N — CID 98044022
(3R,4R)-1-benzyl-3,4-bis(chloromethyl)pyrrolidine (PubChem CID 98044022) has the molecular formula C13H17Cl2N and a molecular weight of 258.19 g/mol. Its IUPAC name is (3R,4R)-1-benzyl-3,4-bis(chloromethyl)pyrrolidine.
| Compound Name | (3R,4R)-1-benzyl-3,4-bis(chloromethyl)pyrrolidine |
|---|---|
| PubChem CID | 98044022 |
| Molecular Formula | C13H17Cl2N |
| Molecular Weight | 258.19 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | (3R,4R)-1-benzyl-3,4-bis(chloromethyl)pyrrolidine |
| SMILES | ClC[C@H]1CN(Cc2ccccc2)C[C@@H]1CCl |
| InChI | InChI=1S/C13H17Cl2N/c14-6-12-9-16(10-13(12)7-15)8-11-4-2-1-3-5-11/h1-5,12-13H,6-10H2/t12-,13-/m0/s1 |
| InChIKey | KHKYBJCQIVAHGL-STQMWFEESA-N |
| XLogP | 3.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.19 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|