C16H22N2O5 — CID 70563777
(3R,4S)-4-(aminomethyl)-1-benzylpyrrolidin-3-ol;(Z)-but-2-enedioic acid (PubChem CID 70563777) has the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. Its IUPAC name is (3R,4S)-4-(aminomethyl)-1-benzylpyrrolidin-3-ol;(Z)-but-2-enedioic acid.
| Compound Name | (3R,4S)-4-(aminomethyl)-1-benzylpyrrolidin-3-ol;(Z)-but-2-enedioic acid |
|---|---|
| PubChem CID | 70563777 |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | (3R,4S)-4-(aminomethyl)-1-benzylpyrrolidin-3-ol;(Z)-but-2-enedioic acid |
| SMILES | NC[C@H]1CN(Cc2ccccc2)C[C@@H]1O.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C12H18N2O.C4H4O4/c13-6-11-8-14(9-12(11)15)7-10-4-2-1-3-5-10;5-3(6)1-2-4(7)8/h1-5,11-12,15H,6-9,13H2;1-2H,(H,5,6)(H,7,8)/b;2-1-/t11-,12-;/m0./s1 |
| InChIKey | LKNZPQTUXMYJRK-DTJRTYIZSA-N |
| XLogP | 0.15 |
| TPSA | 124.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|