C16H23NO3 — CID 86708998
ethyl (3R,4R)-3-[[(1S)-1-phenylethyl]amino]oxane-4-carboxylate (PubChem CID 86708998) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is ethyl (3R,4R)-3-[[(1S)-1-phenylethyl]amino]oxane-4-carboxylate.
| Compound Name | ethyl (3R,4R)-3-[[(1S)-1-phenylethyl]amino]oxane-4-carboxylate |
|---|---|
| PubChem CID | 86708998 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | ethyl (3R,4R)-3-[[(1S)-1-phenylethyl]amino]oxane-4-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCOC[C@@H]1N[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C16H23NO3/c1-3-20-16(18)14-9-10-19-11-15(14)17-12(2)13-7-5-4-6-8-13/h4-8,12,14-15,17H,3,9-11H2,1-2H3/t12-,14+,15-/m0/s1 |
| InChIKey | XXVAOXMOQYFDMH-CFVMTHIKSA-N |
| XLogP | 2.31 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |