C19H27NO2 — CID 57012477
ethyl 2-[[cyclopropyl(phenyl)methyl]amino]cyclohexane-1-carboxylate (PubChem CID 57012477) has the molecular formula C19H27NO2 and a molecular weight of 301.43 g/mol. Its IUPAC name is ethyl 2-[[cyclopropyl(phenyl)methyl]amino]cyclohexane-1-carboxylate.
| Compound Name | ethyl 2-[[cyclopropyl(phenyl)methyl]amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 57012477 |
| Molecular Formula | C19H27NO2 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | ethyl 2-[[cyclopropyl(phenyl)methyl]amino]cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCCCC1NC(c1ccccc1)C1CC1 |
| InChI | InChI=1S/C19H27NO2/c1-2-22-19(21)16-10-6-7-11-17(16)20-18(15-12-13-15)14-8-4-3-5-9-14/h3-5,8-9,15-18,20H,2,6-7,10-13H2,1H3 |
| InChIKey | MRQARSNNNZSJJF-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |