C24H30NO3P — CID 135033787
cis-ethyl (1R,2S)-2-[[(2S,5S)-1-oxo-2,5-diphenyl-1λ5-phospholan-1-yl]amino]cyclopentane-1-carboxylate (PubChem CID 135033787) has the molecular formula C24H30NO3P and a molecular weight of 411.48 g/mol. Its IUPAC name is cis-ethyl (1R,2S)-2-[[(2S,5S)-1-oxo-2,5-diphenyl-1λ5-phospholan-1-yl]amino]cyclopentane-1-carboxylate.
| Compound Name | cis-ethyl (1R,2S)-2-[[(2S,5S)-1-oxo-2,5-diphenyl-1λ5-phospholan-1-yl]amino]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 135033787 |
| Molecular Formula | C24H30NO3P |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | cis-ethyl (1R,2S)-2-[[(2S,5S)-1-oxo-2,5-diphenyl-1λ5-phospholan-1-yl]amino]cyclopentane-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCC[C@@H]1NP1(=O)[C@H](c2ccccc2)CC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C24H30NO3P/c1-2-28-24(26)20-14-9-15-21(20)25-29(27)22(18-10-5-3-6-11-18)16-17-23(29)19-12-7-4-8-13-19/h3-8,10-13,20-23H,2,9,14-17H2,1H3,(H,25,27)/t20-,21+,22+,23+/m1/s1 |
| InChIKey | STGDIGKLDOBIJS-LDVJMBRRSA-N |
| XLogP | 5.86 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|