C13H15NO3 — CID 142553766
ethyl (3R,4S)-5-oxo-4-phenylpyrrolidine-3-carboxylate (PubChem CID 142553766) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is ethyl (3R,4S)-5-oxo-4-phenylpyrrolidine-3-carboxylate.
| Compound Name | ethyl (3R,4S)-5-oxo-4-phenylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 142553766 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | ethyl (3R,4S)-5-oxo-4-phenylpyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CNC(=O)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C13H15NO3/c1-2-17-13(16)10-8-14-12(15)11(10)9-6-4-3-5-7-9/h3-7,10-11H,2,8H2,1H3,(H,14,15)/t10-,11+/m0/s1 |
| InChIKey | HDTWFVJGEJAPDF-WDEREUQCSA-N |
| XLogP | 1.08 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |