C7H11NO4 — CID 130007839
ethyl 4-hydroxy-5-oxopyrrolidine-3-carboxylate (PubChem CID 130007839) has the molecular formula C7H11NO4 and a molecular weight of 173.17 g/mol. Its IUPAC name is ethyl 4-hydroxy-5-oxopyrrolidine-3-carboxylate.
| Compound Name | ethyl 4-hydroxy-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 130007839 |
| Molecular Formula | C7H11NO4 |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | ethyl 4-hydroxy-5-oxopyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)C1CNC(=O)C1O |
| InChI | InChI=1S/C7H11NO4/c1-2-12-7(11)4-3-8-6(10)5(4)9/h4-5,9H,2-3H2,1H3,(H,8,10) |
| InChIKey | RJAPZHKRIKQIMJ-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |