C11H16O5 — CID 26967535
cis-diethyl (1S,2R)-4-oxocyclopentane-1,2-dicarboxylate (PubChem CID 26967535) has the molecular formula C11H16O5 and a molecular weight of 228.24 g/mol. Its IUPAC name is cis-diethyl (1S,2R)-4-oxocyclopentane-1,2-dicarboxylate.
| Compound Name | cis-diethyl (1S,2R)-4-oxocyclopentane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 26967535 |
| Molecular Formula | C11H16O5 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | cis-diethyl (1S,2R)-4-oxocyclopentane-1,2-dicarboxylate |
| SMILES | CCOC(=O)[C@H]1CC(=O)C[C@H]1C(=O)OCC |
| InChI | InChI=1S/C11H16O5/c1-3-15-10(13)8-5-7(12)6-9(8)11(14)16-4-2/h8-9H,3-6H2,1-2H3/t8-,9+ |
| InChIKey | GRPKMLGYFVVOJS-DTORHVGOSA-N |
| XLogP | 0.71 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |