C12H18O4 — CID 36691021
(1R,6R)-6-ethoxycarbonyl-3,4-dimethylcyclohex-3-ene-1-carboxylic acid (PubChem CID 36691021) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is (1R,6R)-6-ethoxycarbonyl-3,4-dimethylcyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1R,6R)-6-ethoxycarbonyl-3,4-dimethylcyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 36691021 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | (1R,6R)-6-ethoxycarbonyl-3,4-dimethylcyclohex-3-ene-1-carboxylic acid |
| SMILES | CCOC(=O)[C@@H]1CC(C)=C(C)C[C@H]1C(=O)O |
| InChI | InChI=1S/C12H18O4/c1-4-16-12(15)10-6-8(3)7(2)5-9(10)11(13)14/h9-10H,4-6H2,1-3H3,(H,13,14)/t9-,10-/m1/s1 |
| InChIKey | VLNFTGMIORIHCQ-NXEZZACHSA-N |
| XLogP | 2.00 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|