C10H16ClLiO2 — CID 139342927
lithium;ethyl 3,4-dimethylcyclopent-3-ene-1-carboxylate;chloride (PubChem CID 139342927) has the molecular formula C10H16ClLiO2 and a molecular weight of 210.63 g/mol. Its IUPAC name is lithium;ethyl 3,4-dimethylcyclopent-3-ene-1-carboxylate;chloride.
| Compound Name | lithium;ethyl 3,4-dimethylcyclopent-3-ene-1-carboxylate;chloride |
|---|---|
| PubChem CID | 139342927 |
| Molecular Formula | C10H16ClLiO2 |
| Molecular Weight | 210.63 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | lithium;ethyl 3,4-dimethylcyclopent-3-ene-1-carboxylate;chloride |
| SMILES | CCOC(=O)C1CC(C)=C(C)C1.[Cl-].[Li+] |
| InChI | InChI=1S/C10H16O2.ClH.Li/c1-4-12-10(11)9-5-7(2)8(3)6-9;;/h9H,4-6H2,1-3H3;1H;/q;;+1/p-1 |
| InChIKey | NILWLZVYJGUQCY-UHFFFAOYSA-M |
| XLogP | -3.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.63 |
| LogP ≤ 5 | -3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|