C14H20O5 — CID 21276347
ethyl 4-(2,2-dimethylpropanoyl)-3,5-dioxocyclohexane-1-carboxylate (PubChem CID 21276347) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is ethyl 4-(2,2-dimethylpropanoyl)-3,5-dioxocyclohexane-1-carboxylate.
| Compound Name | ethyl 4-(2,2-dimethylpropanoyl)-3,5-dioxocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 21276347 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | ethyl 4-(2,2-dimethylpropanoyl)-3,5-dioxocyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CC(=O)C(C(=O)C(C)(C)C)C(=O)C1 |
| InChI | InChI=1S/C14H20O5/c1-5-19-13(18)8-6-9(15)11(10(16)7-8)12(17)14(2,3)4/h8,11H,5-7H2,1-4H3 |
| InChIKey | QDDPKHPGDSXUMD-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|