C15H24O5 — CID 143769364
ethane;ethyl 4-(1-hydroxybutylidene)-3,5-dioxocyclohexane-1-carboxylate (PubChem CID 143769364) has the molecular formula C15H24O5 and a molecular weight of 284.35 g/mol. Its IUPAC name is ethane;ethyl 4-(1-hydroxybutylidene)-3,5-dioxocyclohexane-1-carboxylate.
| Compound Name | ethane;ethyl 4-(1-hydroxybutylidene)-3,5-dioxocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 143769364 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | ethane;ethyl 4-(1-hydroxybutylidene)-3,5-dioxocyclohexane-1-carboxylate |
| SMILES | CC.CCCC(O)=C1C(=O)CC(C(=O)OCC)CC1=O |
| InChI | InChI=1S/C13H18O5.C2H6/c1-3-5-9(14)12-10(15)6-8(7-11(12)16)13(17)18-4-2;1-2/h8,14H,3-7H2,1-2H3;1-2H3/b12-9-; |
| InChIKey | GSGQXLNUARKSBW-MWMYENNMSA-N |
| XLogP | 2.74 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|