C19H30O5Si — CID 91741927
ethyl 4-[[tert-butyl(dimethyl)silyl]oxy-cyclopropylmethylidene]-3,5-dioxocyclohexane-1-carboxylate (PubChem CID 91741927) has the molecular formula C19H30O5Si and a molecular weight of 366.53 g/mol. Its IUPAC name is ethyl 4-[[tert-butyl(dimethyl)silyl]oxy-cyclopropylmethylidene]-3,5-dioxocyclohexane-1-carboxylate.
| Compound Name | ethyl 4-[[tert-butyl(dimethyl)silyl]oxy-cyclopropylmethylidene]-3,5-dioxocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 91741927 |
| Molecular Formula | C19H30O5Si |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | ethyl 4-[[tert-butyl(dimethyl)silyl]oxy-cyclopropylmethylidene]-3,5-dioxocyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CC(=O)C(=C(O[Si](C)(C)C(C)(C)C)C2CC2)C(=O)C1 |
| InChI | InChI=1S/C19H30O5Si/c1-7-23-18(22)13-10-14(20)16(15(21)11-13)17(12-8-9-12)24-25(5,6)19(2,3)4/h12-13H,7-11H2,1-6H3/b17-16- |
| InChIKey | NFGSVZDMMZKICN-MSUUIHNZSA-N |
| XLogP | 3.78 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|