C12H19NO4 — CID 154637444
ethyl 1-tert-butyl-2,4-dioxopiperidine-3-carboxylate (PubChem CID 154637444) has the molecular formula C12H19NO4 and a molecular weight of 241.29 g/mol. Its IUPAC name is ethyl 1-tert-butyl-2,4-dioxopiperidine-3-carboxylate.
| Compound Name | ethyl 1-tert-butyl-2,4-dioxopiperidine-3-carboxylate |
|---|---|
| PubChem CID | 154637444 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | ethyl 1-tert-butyl-2,4-dioxopiperidine-3-carboxylate |
| SMILES | CCOC(=O)C1C(=O)CCN(C(C)(C)C)C1=O |
| InChI | InChI=1S/C12H19NO4/c1-5-17-11(16)9-8(14)6-7-13(10(9)15)12(2,3)4/h9H,5-7H2,1-4H3 |
| InChIKey | GQXLVKBFZZMXDZ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|