C13H21NO4 — CID 154637383
ethyl 1-(2,2-dimethylpropyl)-2,4-dioxopiperidine-3-carboxylate (PubChem CID 154637383) has the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. Its IUPAC name is ethyl 1-(2,2-dimethylpropyl)-2,4-dioxopiperidine-3-carboxylate.
| Compound Name | ethyl 1-(2,2-dimethylpropyl)-2,4-dioxopiperidine-3-carboxylate |
|---|---|
| PubChem CID | 154637383 |
| Molecular Formula | C13H21NO4 |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | ethyl 1-(2,2-dimethylpropyl)-2,4-dioxopiperidine-3-carboxylate |
| SMILES | CCOC(=O)C1C(=O)CCN(CC(C)(C)C)C1=O |
| InChI | InChI=1S/C13H21NO4/c1-5-18-12(17)10-9(15)6-7-14(11(10)16)8-13(2,3)4/h10H,5-8H2,1-4H3 |
| InChIKey | YMZHGTQRTYBLKX-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|