C10H15NO3 — CID 130432586
ethyl 2-oxo-1,3,5,6,7,8-hexahydropyrrolizine-3-carboxylate (PubChem CID 130432586) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is ethyl 2-oxo-1,3,5,6,7,8-hexahydropyrrolizine-3-carboxylate.
| Compound Name | ethyl 2-oxo-1,3,5,6,7,8-hexahydropyrrolizine-3-carboxylate |
|---|---|
| PubChem CID | 130432586 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | ethyl 2-oxo-1,3,5,6,7,8-hexahydropyrrolizine-3-carboxylate |
| SMILES | CCOC(=O)C1C(=O)CC2CCCN21 |
| InChI | InChI=1S/C10H15NO3/c1-2-14-10(13)9-8(12)6-7-4-3-5-11(7)9/h7,9H,2-6H2,1H3 |
| InChIKey | YBGLNAVTAVVIBS-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|