C14H21NO3 — CID 102174312
ethyl (1R,4R,5S,8R)-6-oxo-12-azatricyclo[6.3.1.04,12]dodecane-5-carboxylate (PubChem CID 102174312) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is ethyl (1R,4R,5S,8R)-6-oxo-12-azatricyclo[6.3.1.04,12]dodecane-5-carboxylate.
| Compound Name | ethyl (1R,4R,5S,8R)-6-oxo-12-azatricyclo[6.3.1.04,12]dodecane-5-carboxylate |
|---|---|
| PubChem CID | 102174312 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | ethyl (1R,4R,5S,8R)-6-oxo-12-azatricyclo[6.3.1.04,12]dodecane-5-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C(=O)C[C@H]2CCC[C@@H]3CC[C@H]1N32 |
| InChI | InChI=1S/C14H21NO3/c1-2-18-14(17)13-11-7-6-9-4-3-5-10(15(9)11)8-12(13)16/h9-11,13H,2-8H2,1H3/t9-,10-,11-,13+/m1/s1 |
| InChIKey | CZCKCNWGGRFLJB-UZWSLXQKSA-N |
| XLogP | 1.52 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|