C13H21NO3 — CID 70276804
tert-butyl 8-methyl-3-oxo-8-azabicyclo[3.2.1]octane-2-carboxylate (PubChem CID 70276804) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is tert-butyl 8-methyl-3-oxo-8-azabicyclo[3.2.1]octane-2-carboxylate.
| Compound Name | tert-butyl 8-methyl-3-oxo-8-azabicyclo[3.2.1]octane-2-carboxylate |
|---|---|
| PubChem CID | 70276804 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | tert-butyl 8-methyl-3-oxo-8-azabicyclo[3.2.1]octane-2-carboxylate |
| SMILES | CN1C2CCC1C(C(=O)OC(C)(C)C)C(=O)C2 |
| InChI | InChI=1S/C13H21NO3/c1-13(2,3)17-12(16)11-9-6-5-8(14(9)4)7-10(11)15/h8-9,11H,5-7H2,1-4H3 |
| InChIKey | UMRPZZRPGYUNSL-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|