About CID 175957465
CID 175957465 (PubChem CID 175957465) has the molecular formula C12H15F3NaO4
and a molecular weight of 303.23 g/mol.
Molecular Properties
| Compound Name | CID 175957465 |
| PubChem CID | 175957465 |
| Molecular Formula | C12H15F3NaO4 |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | — |
| SMILES | CC(C)(C)OC(=O)C1C(=O)CC(=O)CC1C(F)(F)F.[Na] |
| InChI | InChI=1S/C12H15F3O4.Na/c1-11(2,3)19-10(18)9-7(12(13,14)15)4-6(16)5-8(9)17;/h7,9H,4-5H2,1-3H3; |
| InChIKey | SEVWDSSNEWDUNS-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze CID 175957465 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175957465?
The IUPAC name of CID 175957465 (CID 175957465) is not available.
What is the SMILES notation for CID 175957465?
The canonical SMILES for CID 175957465 is CC(C)(C)OC(=O)C1C(=O)CC(=O)CC1C(F)(F)F.[Na].
What is the InChIKey of CID 175957465?
The InChIKey is SEVWDSSNEWDUNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15F3O4.Na/c1-11(2,3)19-10(18)9-7(12(13,14)15)4-6(16)5-8(9)17;/h7,9H,4-5H2,1-3H3;.
What are the key properties of CID 175957465?
CID 175957465 has a molecular weight of 303.23 g/mol, XLogP of 1.67, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175957465 is sourced from PubChem (CID 175957465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).