C20H20O4 — CID 117069471
tert-butyl 2,4-dioxohexacyclo[7.6.0.01,5.05,12.06,10.011,15]pentadeca-7,13-diene-3-carboxylate (PubChem CID 117069471) has the molecular formula C20H20O4 and a molecular weight of 324.38 g/mol. Its IUPAC name is tert-butyl 2,4-dioxohexacyclo[7.6.0.01,5.05,12.06,10.011,15]pentadeca-7,13-diene-3-carboxylate.
| Compound Name | tert-butyl 2,4-dioxohexacyclo[7.6.0.01,5.05,12.06,10.011,15]pentadeca-7,13-diene-3-carboxylate |
|---|---|
| PubChem CID | 117069471 |
| Molecular Formula | C20H20O4 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | tert-butyl 2,4-dioxohexacyclo[7.6.0.01,5.05,12.06,10.011,15]pentadeca-7,13-diene-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1C(=O)C23C4C=CC5C4C4C2C=CC4C53C1=O |
| InChI | InChI=1S/C20H20O4/c1-18(2,3)24-17(23)14-15(21)19-8-4-5-9-12(8)13-10(19)6-7-11(13)20(9,19)16(14)22/h4-14H,1-3H3 |
| InChIKey | YMPVBNQCRVSNFU-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|